C29H38N4O3 — CID 42675297
5-benzamido-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide (PubChem CID 42675297) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 5-benzamido-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide.
| Compound Name | 5-benzamido-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 42675297 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 5-benzamido-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2ccccc2)ccc1N1CCCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C29H38N4O3/c1-3-31(4-2)29(36)25-21-24(30-27(34)22-11-6-5-7-12-22)15-16-26(25)32-17-10-18-33(20-19-32)28(35)23-13-8-9-14-23/h5-7,11-12,15-16,21,23H,3-4,8-10,13-14,17-20H2,1-2H3,(H,30,34) |
| InChIKey | YKOUZIRHEFSLNX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|