C27H33FN4O3 — CID 42675257
2-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethyl-5-[(3-fluorobenzoyl)amino]benzamide (PubChem CID 42675257) has the molecular formula C27H33FN4O3 and a molecular weight of 480.58 g/mol. Its IUPAC name is 2-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethyl-5-[(3-fluorobenzoyl)amino]benzamide.
| Compound Name | 2-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethyl-5-[(3-fluorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 42675257 |
| Molecular Formula | C27H33FN4O3 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 2-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethyl-5-[(3-fluorobenzoyl)amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2cccc(F)c2)ccc1N1CCCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C27H33FN4O3/c1-3-30(4-2)27(35)23-18-22(29-25(33)20-7-5-8-21(28)17-20)11-12-24(23)31-13-6-14-32(16-15-31)26(34)19-9-10-19/h5,7-8,11-12,17-19H,3-4,6,9-10,13-16H2,1-2H3,(H,29,33) |
| InChIKey | GMSZOLSUKZPBBB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|