C26H31FN4O3 — CID 42673115
2-[4-(cyclopropanecarbonyl)piperazin-1-yl]-N,N-diethyl-5-[(2-fluorobenzoyl)amino]benzamide (PubChem CID 42673115) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[4-(cyclopropanecarbonyl)piperazin-1-yl]-N,N-diethyl-5-[(2-fluorobenzoyl)amino]benzamide.
| Compound Name | 2-[4-(cyclopropanecarbonyl)piperazin-1-yl]-N,N-diethyl-5-[(2-fluorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 42673115 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-[4-(cyclopropanecarbonyl)piperazin-1-yl]-N,N-diethyl-5-[(2-fluorobenzoyl)amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2ccccc2F)ccc1N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C26H31FN4O3/c1-3-29(4-2)26(34)21-17-19(28-24(32)20-7-5-6-8-22(20)27)11-12-23(21)30-13-15-31(16-14-30)25(33)18-9-10-18/h5-8,11-12,17-18H,3-4,9-10,13-16H2,1-2H3,(H,28,32) |
| InChIKey | OIZCRWWLDRYSMS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|