C26H32FN5O3 — CID 42673291
4-[4-(cyclopropanecarbonylamino)-2-(diethylcarbamoyl)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 42673291) has the molecular formula C26H32FN5O3 and a molecular weight of 481.57 g/mol. Its IUPAC name is 4-[4-(cyclopropanecarbonylamino)-2-(diethylcarbamoyl)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-(cyclopropanecarbonylamino)-2-(diethylcarbamoyl)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42673291 |
| Molecular Formula | C26H32FN5O3 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 4-[4-(cyclopropanecarbonylamino)-2-(diethylcarbamoyl)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)C2CC2)ccc1N1CCN(C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C26H32FN5O3/c1-3-30(4-2)25(34)20-17-19(28-24(33)18-9-10-18)11-12-23(20)31-13-15-32(16-14-31)26(35)29-22-8-6-5-7-21(22)27/h5-8,11-12,17-18H,3-4,9-10,13-16H2,1-2H3,(H,28,33)(H,29,35) |
| InChIKey | XZRLCKROSLGKLW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|