C31H33F2N5O3 — CID 42678745
4-[4-(cyclobutanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide (PubChem CID 42678745) has the molecular formula C31H33F2N5O3 and a molecular weight of 561.63 g/mol. Its IUPAC name is 4-[4-(cyclobutanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[4-(cyclobutanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42678745 |
| Molecular Formula | C31H33F2N5O3 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | 4-[4-(cyclobutanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cc(NC(=O)C2CCC2)ccc1N1CCCN(C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C31H33F2N5O3/c32-23-11-9-21(10-12-23)20-34-30(40)25-19-24(35-29(39)22-5-3-6-22)13-14-28(25)37-15-4-16-38(18-17-37)31(41)36-27-8-2-1-7-26(27)33/h1-2,7-14,19,22H,3-6,15-18,20H2,(H,34,40)(H,35,39)(H,36,41) |
| InChIKey | QUJLUJASCYZONW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|