C25H25F2N5O2 — CID 42677352
4-[4-amino-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 42677352) has the molecular formula C25H25F2N5O2 and a molecular weight of 465.50 g/mol. Its IUPAC name is 4-[4-amino-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-amino-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42677352 |
| Molecular Formula | C25H25F2N5O2 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 4-[4-amino-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | Nc1ccc(N2CCN(C(=O)Nc3ccccc3F)CC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H25F2N5O2/c26-18-7-5-17(6-8-18)16-29-24(33)20-15-19(28)9-10-23(20)31-11-13-32(14-12-31)25(34)30-22-4-2-1-3-21(22)27/h1-10,15H,11-14,16,28H2,(H,29,33)(H,30,34) |
| InChIKey | LEHZFFSTUHOQJD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|