C29H28F2N4O3 — CID 42678082
2-[4-(cyclopropanecarbonyl)piperazin-1-yl]-5-[(2-fluorobenzoyl)amino]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 42678082) has the molecular formula C29H28F2N4O3 and a molecular weight of 518.56 g/mol. Its IUPAC name is 2-[4-(cyclopropanecarbonyl)piperazin-1-yl]-5-[(2-fluorobenzoyl)amino]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 2-[4-(cyclopropanecarbonyl)piperazin-1-yl]-5-[(2-fluorobenzoyl)amino]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42678082 |
| Molecular Formula | C29H28F2N4O3 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-[4-(cyclopropanecarbonyl)piperazin-1-yl]-5-[(2-fluorobenzoyl)amino]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)C3CC3)CC2)c(C(=O)NCc2ccc(F)cc2)c1)c1ccccc1F |
| InChI | InChI=1S/C29H28F2N4O3/c30-21-9-5-19(6-10-21)18-32-27(36)24-17-22(33-28(37)23-3-1-2-4-25(23)31)11-12-26(24)34-13-15-35(16-14-34)29(38)20-7-8-20/h1-6,9-12,17,20H,7-8,13-16,18H2,(H,32,36)(H,33,37) |
| InChIKey | KMBIYROCRVLYBQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|