C33H37FN4O3 — CID 42678253
2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N-[(4-fluorophenyl)methyl]-5-[(4-methylbenzoyl)amino]benzamide (PubChem CID 42678253) has the molecular formula C33H37FN4O3 and a molecular weight of 556.68 g/mol. Its IUPAC name is 2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N-[(4-fluorophenyl)methyl]-5-[(4-methylbenzoyl)amino]benzamide.
| Compound Name | 2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N-[(4-fluorophenyl)methyl]-5-[(4-methylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 42678253 |
| Molecular Formula | C33H37FN4O3 |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N-[(4-fluorophenyl)methyl]-5-[(4-methylbenzoyl)amino]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCCN(C(=O)C4CCCC4)CC3)c(C(=O)NCc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C33H37FN4O3/c1-23-7-11-25(12-8-23)31(39)36-28-15-16-30(29(21-28)32(40)35-22-24-9-13-27(34)14-10-24)37-17-4-18-38(20-19-37)33(41)26-5-2-3-6-26/h7-16,21,26H,2-6,17-20,22H2,1H3,(H,35,40)(H,36,39) |
| InChIKey | JUJSEILPWQJKTP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|