C31H34ClFN4O3 — CID 42678186
5-[(4-chlorobenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 42678186) has the molecular formula C31H34ClFN4O3 and a molecular weight of 565.09 g/mol. Its IUPAC name is 5-[(4-chlorobenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | 5-[(4-chlorobenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 42678186 |
| Molecular Formula | C31H34ClFN4O3 |
| Molecular Weight | 565.09 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 5-[(4-chlorobenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | CC(C)CC(=O)N1CCCN(c2ccc(NC(=O)c3ccc(Cl)cc3)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C31H34ClFN4O3/c1-21(2)18-29(38)37-15-3-14-36(16-17-37)28-13-12-26(35-30(39)23-6-8-24(32)9-7-23)19-27(28)31(40)34-20-22-4-10-25(33)11-5-22/h4-13,19,21H,3,14-18,20H2,1-2H3,(H,34,40)(H,35,39) |
| InChIKey | RXWHTDPCMOCKMD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.09 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|