C28H35FN4O3 — CID 42678066
5-(cyclobutanecarbonylamino)-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)piperazin-1-yl]benzamide (PubChem CID 42678066) has the molecular formula C28H35FN4O3 and a molecular weight of 494.61 g/mol. Its IUPAC name is 5-(cyclobutanecarbonylamino)-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)piperazin-1-yl]benzamide.
| Compound Name | 5-(cyclobutanecarbonylamino)-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42678066 |
| Molecular Formula | C28H35FN4O3 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 5-(cyclobutanecarbonylamino)-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)piperazin-1-yl]benzamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)C3CCC3)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H35FN4O3/c1-19(2)16-26(34)33-14-12-32(13-15-33)25-11-10-23(31-27(35)21-4-3-5-21)17-24(25)28(36)30-18-20-6-8-22(29)9-7-20/h6-11,17,19,21H,3-5,12-16,18H2,1-2H3,(H,30,36)(H,31,35) |
| InChIKey | OYMNXGQHUCUJOH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|