C26H38N4O3 — CID 42678380
N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide (PubChem CID 42678380) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 42678380 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)C3CCC3)cc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C26H38N4O3/c1-19(2)17-24(31)29-15-13-28(14-16-29)23-10-9-21(27-25(32)20-7-6-8-20)18-22(23)26(33)30-11-4-3-5-12-30/h9-10,18-20H,3-8,11-17H2,1-2H3,(H,27,32) |
| InChIKey | BHEKEELKDCSMDF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|