C26H36N4O3 — CID 42678524
N-[4-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide (PubChem CID 42678524) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[4-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 42678524 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | N-[4-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)c(C(=O)N2CCCCC2)c1)C1CCC1 |
| InChI | InChI=1S/C26H36N4O3/c31-24(19-6-4-7-19)27-21-10-11-23(22(18-21)26(33)29-12-2-1-3-13-29)28-14-5-15-30(17-16-28)25(32)20-8-9-20/h10-11,18-20H,1-9,12-17H2,(H,27,31) |
| InChIKey | YJBWALXDLYLICT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|