C30H30F2N4O3 — CID 42678089
5-(cyclobutanecarbonylamino)-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 42678089) has the molecular formula C30H30F2N4O3 and a molecular weight of 532.59 g/mol. Its IUPAC name is 5-(cyclobutanecarbonylamino)-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 5-(cyclobutanecarbonylamino)-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42678089 |
| Molecular Formula | C30H30F2N4O3 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 5-(cyclobutanecarbonylamino)-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cc(NC(=O)C2CCC2)ccc1N1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C30H30F2N4O3/c31-22-10-8-20(9-11-22)19-33-29(38)25-18-23(34-28(37)21-4-3-5-21)12-13-27(25)35-14-16-36(17-15-35)30(39)24-6-1-2-7-26(24)32/h1-2,6-13,18,21H,3-5,14-17,19H2,(H,33,38)(H,34,37) |
| InChIKey | HYPDLGJHZJTBEP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|