C30H26F2N4O3S — CID 42678090
N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]-3-[(4-fluorophenyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 42678090) has the molecular formula C30H26F2N4O3S and a molecular weight of 560.63 g/mol. Its IUPAC name is N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]-3-[(4-fluorophenyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]-3-[(4-fluorophenyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42678090 |
| Molecular Formula | C30H26F2N4O3S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]-3-[(4-fluorophenyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)c(C(=O)NCc2ccc(F)cc2)c1)c1cccs1 |
| InChI | InChI=1S/C30H26F2N4O3S/c31-21-9-7-20(8-10-21)19-33-28(37)24-18-22(34-29(38)27-6-3-17-40-27)11-12-26(24)35-13-15-36(16-14-35)30(39)23-4-1-2-5-25(23)32/h1-12,17-18H,13-16,19H2,(H,33,37)(H,34,38) |
| InChIKey | SJUNSPLNAKPXRR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|