C27H33FN4O3 — CID 42673121
5-(cyclobutanecarbonylamino)-N,N-diethyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]benzamide (PubChem CID 42673121) has the molecular formula C27H33FN4O3 and a molecular weight of 480.58 g/mol. Its IUPAC name is 5-(cyclobutanecarbonylamino)-N,N-diethyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]benzamide.
| Compound Name | 5-(cyclobutanecarbonylamino)-N,N-diethyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42673121 |
| Molecular Formula | C27H33FN4O3 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 5-(cyclobutanecarbonylamino)-N,N-diethyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)C2CCC2)ccc1N1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H33FN4O3/c1-3-30(4-2)27(35)22-18-20(29-25(33)19-8-7-9-19)12-13-24(22)31-14-16-32(17-15-31)26(34)21-10-5-6-11-23(21)28/h5-6,10-13,18-19H,3-4,7-9,14-17H2,1-2H3,(H,29,33) |
| InChIKey | TUAQIRMBEABBEM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|