C29H37ClN4O3 — CID 42676118
2-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]-5-(cyclopentanecarbonylamino)-N,N-diethylbenzamide (PubChem CID 42676118) has the molecular formula C29H37ClN4O3 and a molecular weight of 525.09 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]-5-(cyclopentanecarbonylamino)-N,N-diethylbenzamide.
| Compound Name | 2-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]-5-(cyclopentanecarbonylamino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 42676118 |
| Molecular Formula | C29H37ClN4O3 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]-5-(cyclopentanecarbonylamino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)C2CCCC2)ccc1N1CCCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C29H37ClN4O3/c1-3-32(4-2)29(37)25-20-24(31-27(35)21-8-5-6-9-21)14-15-26(25)33-16-7-17-34(19-18-33)28(36)22-10-12-23(30)13-11-22/h10-15,20-21H,3-9,16-19H2,1-2H3,(H,31,35) |
| InChIKey | IBYOBCUMCWEPKR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|