C27H34N4O3 — CID 42675254
5-benzamido-2-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide (PubChem CID 42675254) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 5-benzamido-2-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide.
| Compound Name | 5-benzamido-2-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 42675254 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 5-benzamido-2-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2ccccc2)ccc1N1CCCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C27H34N4O3/c1-3-29(4-2)27(34)23-19-22(28-25(32)20-9-6-5-7-10-20)13-14-24(23)30-15-8-16-31(18-17-30)26(33)21-11-12-21/h5-7,9-10,13-14,19,21H,3-4,8,11-12,15-18H2,1-2H3,(H,28,32) |
| InChIKey | CHRBZAODODXYNY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|