C30H32Cl2N4O3 — CID 42676112
5-[(2-chlorobenzoyl)amino]-2-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide (PubChem CID 42676112) has the molecular formula C30H32Cl2N4O3 and a molecular weight of 567.52 g/mol. Its IUPAC name is 5-[(2-chlorobenzoyl)amino]-2-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide.
| Compound Name | 5-[(2-chlorobenzoyl)amino]-2-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 42676112 |
| Molecular Formula | C30H32Cl2N4O3 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 5-[(2-chlorobenzoyl)amino]-2-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2ccccc2Cl)ccc1N1CCCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C30H32Cl2N4O3/c1-3-34(4-2)30(39)25-20-23(33-28(37)24-8-5-6-9-26(24)32)14-15-27(25)35-16-7-17-36(19-18-35)29(38)21-10-12-22(31)13-11-21/h5-6,8-15,20H,3-4,7,16-19H2,1-2H3,(H,33,37) |
| InChIKey | YWUVTJKMWXYUFW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|