C27H36ClN5O3 — CID 42673259
N-tert-butyl-4-[4-[(4-chlorobenzoyl)amino]-2-(diethylcarbamoyl)phenyl]piperazine-1-carboxamide (PubChem CID 42673259) has the molecular formula C27H36ClN5O3 and a molecular weight of 514.07 g/mol. Its IUPAC name is N-tert-butyl-4-[4-[(4-chlorobenzoyl)amino]-2-(diethylcarbamoyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[4-[(4-chlorobenzoyl)amino]-2-(diethylcarbamoyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42673259 |
| Molecular Formula | C27H36ClN5O3 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | N-tert-butyl-4-[4-[(4-chlorobenzoyl)amino]-2-(diethylcarbamoyl)phenyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2ccc(Cl)cc2)ccc1N1CCN(C(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H36ClN5O3/c1-6-31(7-2)25(35)22-18-21(29-24(34)19-8-10-20(28)11-9-19)12-13-23(22)32-14-16-33(17-15-32)26(36)30-27(3,4)5/h8-13,18H,6-7,14-17H2,1-5H3,(H,29,34)(H,30,36) |
| InChIKey | LNFRLHGRPISISW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|