C25H32N4O3S — CID 42675249
N-[4-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-3-(diethylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 42675249) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-[4-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-3-(diethylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-3-(diethylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42675249 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-[4-[4-(cyclopropanecarbonyl)-1,4-diazepan-1-yl]-3-(diethylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2cccs2)ccc1N1CCCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C25H32N4O3S/c1-3-27(4-2)25(32)20-17-19(26-23(30)22-7-5-16-33-22)10-11-21(20)28-12-6-13-29(15-14-28)24(31)18-8-9-18/h5,7,10-11,16-18H,3-4,6,8-9,12-15H2,1-2H3,(H,26,30) |
| InChIKey | GGMGAXVHRNOGEA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|