C28H39N5O3S — CID 42673487
N-cyclohexyl-4-[2-(diethylcarbamoyl)-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 42673487) has the molecular formula C28H39N5O3S and a molecular weight of 525.72 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-(diethylcarbamoyl)-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[2-(diethylcarbamoyl)-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42673487 |
| Molecular Formula | C28H39N5O3S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | N-cyclohexyl-4-[2-(diethylcarbamoyl)-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2cccs2)ccc1N1CCCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C28H39N5O3S/c1-3-31(4-2)27(35)23-20-22(29-26(34)25-12-8-19-37-25)13-14-24(23)32-15-9-16-33(18-17-32)28(36)30-21-10-6-5-7-11-21/h8,12-14,19-21H,3-7,9-11,15-18H2,1-2H3,(H,29,34)(H,30,36) |
| InChIKey | FTEIIKQEIDOAHN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|