C26H31FN4O3 — CID 42671930
N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]-2-methylpropanamide (PubChem CID 42671930) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 42671930 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C26H31FN4O3/c1-18(2)24(32)28-19-9-10-23(21(17-19)26(34)30-11-5-6-12-30)29-13-15-31(16-14-29)25(33)20-7-3-4-8-22(20)27/h3-4,7-10,17-18H,5-6,11-16H2,1-2H3,(H,28,32) |
| InChIKey | OPPQQCPFXIEZQI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|