C28H36FN5O3 — CID 42678620
4-[4-(cyclopentanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-propan-2-ylpiperazine-1-carboxamide (PubChem CID 42678620) has the molecular formula C28H36FN5O3 and a molecular weight of 509.63 g/mol. Its IUPAC name is 4-[4-(cyclopentanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[4-(cyclopentanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42678620 |
| Molecular Formula | C28H36FN5O3 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 4-[4-(cyclopentanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-N-propan-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCN(c2ccc(NC(=O)C3CCCC3)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H36FN5O3/c1-19(2)31-28(37)34-15-13-33(14-16-34)25-12-11-23(32-26(35)21-5-3-4-6-21)17-24(25)27(36)30-18-20-7-9-22(29)10-8-20/h7-12,17,19,21H,3-6,13-16,18H2,1-2H3,(H,30,36)(H,31,37)(H,32,35) |
| InChIKey | AWUWQKGBMOZWTO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|