C31H35FN4O3 — CID 42678182
5-benzamido-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 42678182) has the molecular formula C31H35FN4O3 and a molecular weight of 530.64 g/mol. Its IUPAC name is 5-benzamido-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | 5-benzamido-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 42678182 |
| Molecular Formula | C31H35FN4O3 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 5-benzamido-N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | CC(C)CC(=O)N1CCCN(c2ccc(NC(=O)c3ccccc3)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C31H35FN4O3/c1-22(2)19-29(37)36-16-6-15-35(17-18-36)28-14-13-26(34-30(38)24-7-4-3-5-8-24)20-27(28)31(39)33-21-23-9-11-25(32)12-10-23/h3-5,7-14,20,22H,6,15-19,21H2,1-2H3,(H,33,39)(H,34,38) |
| InChIKey | LKZMZUHMZCFNCA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|