C32H37FN4O4 — CID 42678167
N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]-5-(3-methylbutanoylamino)benzamide (PubChem CID 42678167) has the molecular formula C32H37FN4O4 and a molecular weight of 560.67 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]-5-(3-methylbutanoylamino)benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]-5-(3-methylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 42678167 |
| Molecular Formula | C32H37FN4O4 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]-5-(3-methylbutanoylamino)benzamide |
| SMILES | COc1ccc(C(=O)N2CCCN(c3ccc(NC(=O)CC(C)C)cc3C(=O)NCc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H37FN4O4/c1-22(2)19-30(38)35-26-11-14-29(28(20-26)31(39)34-21-23-5-9-25(33)10-6-23)36-15-4-16-37(18-17-36)32(40)24-7-12-27(41-3)13-8-24/h5-14,20,22H,4,15-19,21H2,1-3H3,(H,34,39)(H,35,38) |
| InChIKey | QENKRCLXMAUOAF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|