C31H36FN5O3 — CID 42678629
4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-(3-methylbutanoylamino)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide (PubChem CID 42678629) has the molecular formula C31H36FN5O3 and a molecular weight of 545.66 g/mol. Its IUPAC name is 4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-(3-methylbutanoylamino)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-(3-methylbutanoylamino)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42678629 |
| Molecular Formula | C31H36FN5O3 |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-(3-methylbutanoylamino)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(c3ccc(NC(=O)CC(C)C)cc3C(=O)NCc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H36FN5O3/c1-21(2)18-29(38)34-26-12-13-28(27(19-26)30(39)33-20-23-6-8-24(32)9-7-23)36-14-16-37(17-15-36)31(40)35-25-10-4-22(3)5-11-25/h4-13,19,21H,14-18,20H2,1-3H3,(H,33,39)(H,34,38)(H,35,40) |
| InChIKey | QLYZNVVKENGUNE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|