C28H38FN5O3 — CID 42675475
4-[2-(diethylcarbamoyl)-4-(3-methylbutanoylamino)phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide (PubChem CID 42675475) has the molecular formula C28H38FN5O3 and a molecular weight of 511.64 g/mol. Its IUPAC name is 4-[2-(diethylcarbamoyl)-4-(3-methylbutanoylamino)phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-(diethylcarbamoyl)-4-(3-methylbutanoylamino)phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42675475 |
| Molecular Formula | C28H38FN5O3 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | 4-[2-(diethylcarbamoyl)-4-(3-methylbutanoylamino)phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)CC(C)C)ccc1N1CCCN(C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C28H38FN5O3/c1-5-32(6-2)27(36)22-19-21(30-26(35)18-20(3)4)12-13-25(22)33-14-9-15-34(17-16-33)28(37)31-24-11-8-7-10-23(24)29/h7-8,10-13,19-20H,5-6,9,14-18H2,1-4H3,(H,30,35)(H,31,37) |
| InChIKey | MCMGLUQSUQQYPG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|