C29H35N5O4 — CID 42675448
4-[2-(diethylcarbamoyl)-4-(furan-2-carbonylamino)phenyl]-N-(4-methylphenyl)-1,4-diazepane-1-carboxamide (PubChem CID 42675448) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is 4-[2-(diethylcarbamoyl)-4-(furan-2-carbonylamino)phenyl]-N-(4-methylphenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-(diethylcarbamoyl)-4-(furan-2-carbonylamino)phenyl]-N-(4-methylphenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42675448 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 4-[2-(diethylcarbamoyl)-4-(furan-2-carbonylamino)phenyl]-N-(4-methylphenyl)-1,4-diazepane-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2ccco2)ccc1N1CCCN(C(=O)Nc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C29H35N5O4/c1-4-32(5-2)28(36)24-20-23(30-27(35)26-8-6-19-38-26)13-14-25(24)33-15-7-16-34(18-17-33)29(37)31-22-11-9-21(3)10-12-22/h6,8-14,19-20H,4-5,7,15-18H2,1-3H3,(H,30,35)(H,31,37) |
| InChIKey | XSGJHLGODMDINH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|