C26H28N4O5 — CID 42678369
N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]furan-2-carboxamide (PubChem CID 42678369) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42678369 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(C(=O)N2CCCCC2)c1)c1ccco1 |
| InChI | InChI=1S/C26H28N4O5/c31-24(22-6-4-16-34-22)27-19-8-9-21(20(18-19)25(32)29-10-2-1-3-11-29)28-12-14-30(15-13-28)26(33)23-7-5-17-35-23/h4-9,16-18H,1-3,10-15H2,(H,27,31) |
| InChIKey | TVBNDCDADAVYSV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|