C27H27FN4O5 — CID 42678329
N-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]-3-(morpholine-4-carbonyl)phenyl]furan-2-carboxamide (PubChem CID 42678329) has the molecular formula C27H27FN4O5 and a molecular weight of 506.53 g/mol. Its IUPAC name is N-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]-3-(morpholine-4-carbonyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]-3-(morpholine-4-carbonyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42678329 |
| Molecular Formula | C27H27FN4O5 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]-3-(morpholine-4-carbonyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3cccc(F)c3)CC2)c(C(=O)N2CCOCC2)c1)c1ccco1 |
| InChI | InChI=1S/C27H27FN4O5/c28-20-4-1-3-19(17-20)26(34)31-10-8-30(9-11-31)23-7-6-21(29-25(33)24-5-2-14-37-24)18-22(23)27(35)32-12-15-36-16-13-32/h1-7,14,17-18H,8-13,15-16H2,(H,29,33) |
| InChIKey | CJDNLPCTOZZTAH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|