C29H31FN4O4 — CID 42678536
N-[4-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]furan-2-carboxamide (PubChem CID 42678536) has the molecular formula C29H31FN4O4 and a molecular weight of 518.59 g/mol. Its IUPAC name is N-[4-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42678536 |
| Molecular Formula | C29H31FN4O4 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | N-[4-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCN(C(=O)c3cccc(F)c3)CC2)c(C(=O)N2CCCCC2)c1)c1ccco1 |
| InChI | InChI=1S/C29H31FN4O4/c30-22-8-4-7-21(19-22)28(36)34-15-6-14-32(16-17-34)25-11-10-23(31-27(35)26-9-5-18-38-26)20-24(25)29(37)33-12-2-1-3-13-33/h4-5,7-11,18-20H,1-3,6,12-17H2,(H,31,35) |
| InChIKey | KSFXTGMECDLALT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|