C30H33FN4O4S — CID 42679043
N-[4-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzenesulfonamide (PubChem CID 42679043) has the molecular formula C30H33FN4O4S and a molecular weight of 564.68 g/mol. Its IUPAC name is N-[4-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | N-[4-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42679043 |
| Molecular Formula | C30H33FN4O4S |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | N-[4-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzenesulfonamide |
| SMILES | O=C(c1cccc(F)c1)N1CCCN(c2ccc(NS(=O)(=O)c3ccccc3)cc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C30H33FN4O4S/c31-24-10-7-9-23(21-24)29(36)35-18-8-17-33(19-20-35)28-14-13-25(32-40(38,39)26-11-3-1-4-12-26)22-27(28)30(37)34-15-5-2-6-16-34/h1,3-4,7,9-14,21-22,32H,2,5-6,8,15-20H2 |
| InChIKey | JAGSTCFBWRZJAF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|