C27H37N5O4 — CID 42678931
N-tert-butyl-4-[4-(furan-2-carbonylamino)-2-(piperidine-1-carbonyl)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 42678931) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-tert-butyl-4-[4-(furan-2-carbonylamino)-2-(piperidine-1-carbonyl)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-tert-butyl-4-[4-(furan-2-carbonylamino)-2-(piperidine-1-carbonyl)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42678931 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | N-tert-butyl-4-[4-(furan-2-carbonylamino)-2-(piperidine-1-carbonyl)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCCN(c2ccc(NC(=O)c3ccco3)cc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C27H37N5O4/c1-27(2,3)29-26(35)32-15-8-14-30(16-17-32)22-11-10-20(28-24(33)23-9-7-18-36-23)19-21(22)25(34)31-12-5-4-6-13-31/h7,9-11,18-19H,4-6,8,12-17H2,1-3H3,(H,28,33)(H,29,35) |
| InChIKey | PJOSKGFFGNPIJA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|