C22H24F2N4O3 — CID 25094760
4-(3-fluorobenzoyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)piperazine-1-carboxamide (PubChem CID 25094760) has the molecular formula C22H24F2N4O3 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-(3-fluorobenzoyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(3-fluorobenzoyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 25094760 |
| Molecular Formula | C22H24F2N4O3 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-(3-fluorobenzoyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(F)c1)N1CCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H24F2N4O3/c23-17-3-1-2-16(14-17)21(29)27-6-8-28(9-7-27)22(30)25-18-4-5-20(19(24)15-18)26-10-12-31-13-11-26/h1-5,14-15H,6-13H2,(H,25,30) |
| InChIKey | WGFHZICFLHOTMF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|