C36H33F4N7O9 — CID 161351635
4-(3-fluorobenzoyl)-N-(3-fluoro-4-nitrophenyl)piperazine-1-carboxamide;3-fluoro-4-nitrobenzoic acid;(3-fluorophenyl)-piperazin-1-ylmethanone (PubChem CID 161351635) has the molecular formula C36H33F4N7O9 and a molecular weight of 783.69 g/mol. Its IUPAC name is 4-(3-fluorobenzoyl)-N-(3-fluoro-4-nitrophenyl)piperazine-1-carboxamide;3-fluoro-4-nitrobenzoic acid;(3-fluorophenyl)-piperazin-1-ylmethanone.
| Compound Name | 4-(3-fluorobenzoyl)-N-(3-fluoro-4-nitrophenyl)piperazine-1-carboxamide;3-fluoro-4-nitrobenzoic acid;(3-fluorophenyl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 161351635 |
| Molecular Formula | C36H33F4N7O9 |
| Molecular Weight | 783.69 g/mol |
| Exact Mass | 783.23 |
| IUPAC Name | 4-(3-fluorobenzoyl)-N-(3-fluoro-4-nitrophenyl)piperazine-1-carboxamide;3-fluoro-4-nitrobenzoic acid;(3-fluorophenyl)-piperazin-1-ylmethanone |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(F)c1)N1CCN(C(=O)c2cccc(F)c2)CC1.O=C(O)c1ccc([N+](=O)[O-])c(F)c1.O=C(c1cccc(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C18H16F2N4O4.C11H13FN2O.C7H4FNO4/c19-13-3-1-2-12(10-13)17(25)22-6-8-23(9-7-22)18(26)21-14-4-5-16(24(27)28)15(20)11-14;12-10-3-1-2-9(8-10)11(15)14-6-4-13-5-7-14;8-5-3-4(7(10)11)1-2-6(5)9(12)13/h1-5,10-11H,6-9H2,(H,21,26);1-3,8,13H,4-7H2;1-3H,(H,10,11) |
| InChIKey | VNZRNXFOVNDVNW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 208.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.69 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|