C20H21FN4O4 — CID 56509810
4-(3-fluoro-4-methyl-5-nitrobenzoyl)-N-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 56509810) has the molecular formula C20H21FN4O4 and a molecular weight of 400.41 g/mol. Its IUPAC name is 4-(3-fluoro-4-methyl-5-nitrobenzoyl)-N-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(3-fluoro-4-methyl-5-nitrobenzoyl)-N-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56509810 |
| Molecular Formula | C20H21FN4O4 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-(3-fluoro-4-methyl-5-nitrobenzoyl)-N-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCN(C(=O)c3cc(F)c(C)c([N+](=O)[O-])c3)CC2)c1 |
| InChI | InChI=1S/C20H21FN4O4/c1-13-4-3-5-16(10-13)22-20(27)24-8-6-23(7-9-24)19(26)15-11-17(21)14(2)18(12-15)25(28)29/h3-5,10-12H,6-9H2,1-2H3,(H,22,27) |
| InChIKey | JQPPSQZLZWLIKI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|