C18H17ClFN3O5S — CID 55771389
[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methyl-5-nitrophenyl)methanone (PubChem CID 55771389) has the molecular formula C18H17ClFN3O5S and a molecular weight of 441.87 g/mol. Its IUPAC name is [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methyl-5-nitrophenyl)methanone.
| Compound Name | [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methyl-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 55771389 |
| Molecular Formula | C18H17ClFN3O5S |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methyl-5-nitrophenyl)methanone |
| SMILES | Cc1c(F)cc(C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17ClFN3O5S/c1-12-16(20)10-13(11-17(12)23(25)26)18(24)21-6-8-22(9-7-21)29(27,28)15-4-2-14(19)3-5-15/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | PGPGOSJXJSMCQD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|