C20H22FN3O6S — CID 55770760
[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methyl-5-nitrophenyl)methanone (PubChem CID 55770760) has the molecular formula C20H22FN3O6S and a molecular weight of 451.48 g/mol. Its IUPAC name is [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methyl-5-nitrophenyl)methanone.
| Compound Name | [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methyl-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 55770760 |
| Molecular Formula | C20H22FN3O6S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methyl-5-nitrophenyl)methanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)c3cc(F)c(C)c([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C20H22FN3O6S/c1-3-30-16-4-6-17(7-5-16)31(28,29)23-10-8-22(9-11-23)20(25)15-12-18(21)14(2)19(13-15)24(26)27/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | VORBRGCIQHSLLI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|