C23H27N3O4S — CID 26868969
(2,3-dimethyl-1H-indol-5-yl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 26868969) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26868969 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc4[nH]c(C)c(C)c4c3)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-4-30-19-6-8-20(9-7-19)31(28,29)26-13-11-25(12-14-26)23(27)18-5-10-22-21(15-18)16(2)17(3)24-22/h5-10,15,24H,4,11-14H2,1-3H3 |
| InChIKey | ABBLWOJZJRLTCU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|