C22H24N2O5S — CID 16550716
[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(3-methyl-1-benzofuran-2-yl)methanone (PubChem CID 16550716) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(3-methyl-1-benzofuran-2-yl)methanone.
| Compound Name | [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(3-methyl-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 16550716 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(3-methyl-1-benzofuran-2-yl)methanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)c3oc4ccccc4c3C)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-3-28-17-8-10-18(11-9-17)30(26,27)24-14-12-23(13-15-24)22(25)21-16(2)19-6-4-5-7-20(19)29-21/h4-11H,3,12-15H2,1-2H3 |
| InChIKey | XENMJOQEJVYGNG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |