C24H28N2O6S — CID 71904304
(5-ethoxy-3-methyl-1-benzofuran-2-yl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 71904304) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is (5-ethoxy-3-methyl-1-benzofuran-2-yl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (5-ethoxy-3-methyl-1-benzofuran-2-yl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 71904304 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (5-ethoxy-3-methyl-1-benzofuran-2-yl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)c3oc4ccc(OCC)cc4c3C)CC2)cc1 |
| InChI | InChI=1S/C24H28N2O6S/c1-4-30-18-6-9-20(10-7-18)33(28,29)26-14-12-25(13-15-26)24(27)23-17(3)21-16-19(31-5-2)8-11-22(21)32-23/h6-11,16H,4-5,12-15H2,1-3H3 |
| InChIKey | MOZYLDBTSBVSGT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |