C18H22N2O5S — CID 9326834
[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(2-methylfuran-3-yl)methanone (PubChem CID 9326834) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(2-methylfuran-3-yl)methanone.
| Compound Name | [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(2-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 9326834 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-(2-methylfuran-3-yl)methanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccoc3C)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-3-24-15-4-6-16(7-5-15)26(22,23)20-11-9-19(10-12-20)18(21)17-8-13-25-14(17)2/h4-8,13H,3,9-12H2,1-2H3 |
| InChIKey | KKTLCHZXSJCSTK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |