C19H25N3O4S — CID 5091000
(4-methylpiperazin-1-yl)-(3-methyl-5-pyrrolidin-1-ylsulfonyl-1-benzofuran-2-yl)methanone (PubChem CID 5091000) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-(3-methyl-5-pyrrolidin-1-ylsulfonyl-1-benzofuran-2-yl)methanone.
| Compound Name | (4-methylpiperazin-1-yl)-(3-methyl-5-pyrrolidin-1-ylsulfonyl-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 5091000 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (4-methylpiperazin-1-yl)-(3-methyl-5-pyrrolidin-1-ylsulfonyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCN(C)CC2)oc2ccc(S(=O)(=O)N3CCCC3)cc12 |
| InChI | InChI=1S/C19H25N3O4S/c1-14-16-13-15(27(24,25)22-7-3-4-8-22)5-6-17(16)26-18(14)19(23)21-11-9-20(2)10-12-21/h5-6,13H,3-4,7-12H2,1-2H3 |
| InChIKey | KMOTVZNUOQRSOK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |