C21H21FN2O4S — CID 4526754
N-(4-fluorophenyl)-3-methyl-5-piperidin-1-ylsulfonyl-1-benzofuran-2-carboxamide (PubChem CID 4526754) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-methyl-5-piperidin-1-ylsulfonyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-methyl-5-piperidin-1-ylsulfonyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4526754 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-(4-fluorophenyl)-3-methyl-5-piperidin-1-ylsulfonyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(F)cc2)oc2ccc(S(=O)(=O)N3CCCCC3)cc12 |
| InChI | InChI=1S/C21H21FN2O4S/c1-14-18-13-17(29(26,27)24-11-3-2-4-12-24)9-10-19(18)28-20(14)21(25)23-16-7-5-15(22)6-8-16/h5-10,13H,2-4,11-12H2,1H3,(H,23,25) |
| InChIKey | HZPUZBQAMJJHTL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |