C21H22N2O4S — CID 2373627
3-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 2373627) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2373627 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H22N2O4S/c1-15-18-7-3-4-8-19(18)27-20(15)21(24)22-16-9-11-17(12-10-16)28(25,26)23-13-5-2-6-14-23/h3-4,7-12H,2,5-6,13-14H2,1H3,(H,22,24) |
| InChIKey | KXVYUNXSFSZRLI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |