C20H17Cl2FN2O4 — CID 55951531
(3,4-dichlorophenyl)-[1-(3-fluoro-4-methyl-5-nitrobenzoyl)piperidin-4-yl]methanone (PubChem CID 55951531) has the molecular formula C20H17Cl2FN2O4 and a molecular weight of 439.27 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[1-(3-fluoro-4-methyl-5-nitrobenzoyl)piperidin-4-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[1-(3-fluoro-4-methyl-5-nitrobenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55951531 |
| Molecular Formula | C20H17Cl2FN2O4 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (3,4-dichlorophenyl)-[1-(3-fluoro-4-methyl-5-nitrobenzoyl)piperidin-4-yl]methanone |
| SMILES | Cc1c(F)cc(C(=O)N2CCC(C(=O)c3ccc(Cl)c(Cl)c3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17Cl2FN2O4/c1-11-17(23)9-14(10-18(11)25(28)29)20(27)24-6-4-12(5-7-24)19(26)13-2-3-15(21)16(22)8-13/h2-3,8-10,12H,4-7H2,1H3 |
| InChIKey | HRTLHRKQFUBTIA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|