C19H19ClN2O5S — CID 121192829
[7-(2-chlorophenyl)-1,1-dioxo-1,4-thiazepan-4-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 121192829) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-1,1-dioxo-1,4-thiazepan-4-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [7-(2-chlorophenyl)-1,1-dioxo-1,4-thiazepan-4-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 121192829 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | [7-(2-chlorophenyl)-1,1-dioxo-1,4-thiazepan-4-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(c3ccccc3Cl)S(=O)(=O)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClN2O5S/c1-13-6-7-14(12-17(13)22(24)25)19(23)21-9-8-18(28(26,27)11-10-21)15-4-2-3-5-16(15)20/h2-7,12,18H,8-11H2,1H3 |
| InChIKey | MBJCIGIIDHLPRR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|