C20H20ClNO5S — CID 121192958
[4-[7-(2-chlorophenyl)-1,1-dioxo-1,4-thiazepane-4-carbonyl]phenyl] acetate (PubChem CID 121192958) has the molecular formula C20H20ClNO5S and a molecular weight of 421.90 g/mol. Its IUPAC name is [4-[7-(2-chlorophenyl)-1,1-dioxo-1,4-thiazepane-4-carbonyl]phenyl] acetate.
| Compound Name | [4-[7-(2-chlorophenyl)-1,1-dioxo-1,4-thiazepane-4-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 121192958 |
| Molecular Formula | C20H20ClNO5S |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | [4-[7-(2-chlorophenyl)-1,1-dioxo-1,4-thiazepane-4-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)N2CCC(c3ccccc3Cl)S(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C20H20ClNO5S/c1-14(23)27-16-8-6-15(7-9-16)20(24)22-11-10-19(28(25,26)13-12-22)17-4-2-3-5-18(17)21/h2-9,19H,10-13H2,1H3 |
| InChIKey | MRHBSEREPVTLAW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|