C14H16Cl2N2O3 — CID 61053029
(3,4-dichloro-5-nitrophenyl)-(4-ethylpiperidin-1-yl)methanone (PubChem CID 61053029) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is (3,4-dichloro-5-nitrophenyl)-(4-ethylpiperidin-1-yl)methanone.
| Compound Name | (3,4-dichloro-5-nitrophenyl)-(4-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 61053029 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (3,4-dichloro-5-nitrophenyl)-(4-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCN(C(=O)c2cc(Cl)c(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c1-2-9-3-5-17(6-4-9)14(19)10-7-11(15)13(16)12(8-10)18(20)21/h7-9H,2-6H2,1H3 |
| InChIKey | SRNUURYHMWGIJL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|