C12H12Cl2N2O4 — CID 62059401
(3,4-dichloro-5-nitrophenyl)-(1,4-oxazepan-4-yl)methanone (PubChem CID 62059401) has the molecular formula C12H12Cl2N2O4 and a molecular weight of 319.14 g/mol. Its IUPAC name is (3,4-dichloro-5-nitrophenyl)-(1,4-oxazepan-4-yl)methanone.
| Compound Name | (3,4-dichloro-5-nitrophenyl)-(1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 62059401 |
| Molecular Formula | C12H12Cl2N2O4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (3,4-dichloro-5-nitrophenyl)-(1,4-oxazepan-4-yl)methanone |
| SMILES | O=C(c1cc(Cl)c(Cl)c([N+](=O)[O-])c1)N1CCCOCC1 |
| InChI | InChI=1S/C12H12Cl2N2O4/c13-9-6-8(7-10(11(9)14)16(18)19)12(17)15-2-1-4-20-5-3-15/h6-7H,1-5H2 |
| InChIKey | HEBQOAJSTOOQTI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|